C14H20O3 — CID 134964258
(1R,8S)-10,10-dimethoxytricyclo[6.2.2.01,6]dodec-2-en-9-one (PubChem CID 134964258) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1R,8S)-10,10-dimethoxytricyclo[6.2.2.01,6]dodec-2-en-9-one.
| Compound Name | (1R,8S)-10,10-dimethoxytricyclo[6.2.2.01,6]dodec-2-en-9-one |
|---|---|
| PubChem CID | 134964258 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1R,8S)-10,10-dimethoxytricyclo[6.2.2.01,6]dodec-2-en-9-one |
| SMILES | COC1(OC)C(=O)[C@H]2CC[C@@]13C=CCCC3C2 |
| InChI | InChI=1S/C14H20O3/c1-16-14(17-2)12(15)10-6-8-13(14)7-4-3-5-11(13)9-10/h4,7,10-11H,3,5-6,8-9H2,1-2H3/t10-,11?,13+/m0/s1 |
| InChIKey | KPDKQHDTVZDORX-CCQDYZPNSA-N |
| XLogP | 2.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|