C14H20O3 — CID 10933486
(1R,4R,7S)-7-ethenyl-3,3-dimethoxy-5,7-dimethylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 10933486) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1R,4R,7S)-7-ethenyl-3,3-dimethoxy-5,7-dimethylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1R,4R,7S)-7-ethenyl-3,3-dimethoxy-5,7-dimethylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 10933486 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1R,4R,7S)-7-ethenyl-3,3-dimethoxy-5,7-dimethylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | C=C[C@]1(C)C[C@@H]2C(C)=C[C@H]1C(=O)C2(OC)OC |
| InChI | InChI=1S/C14H20O3/c1-6-13(3)8-11-9(2)7-10(13)12(15)14(11,16-4)17-5/h6-7,10-11H,1,8H2,2-5H3/t10-,11+,13+/m0/s1 |
| InChIKey | ASPIONQODWLRFL-DMDPSCGWSA-N |
| XLogP | 2.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|