C9H15F3O2 — CID 134965073
(E,2R)-2-(trifluoromethyl)oct-3-ene-1,2-diol (PubChem CID 134965073) has the molecular formula C9H15F3O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is (E,2R)-2-(trifluoromethyl)oct-3-ene-1,2-diol.
| Compound Name | (E,2R)-2-(trifluoromethyl)oct-3-ene-1,2-diol |
|---|---|
| PubChem CID | 134965073 |
| Molecular Formula | C9H15F3O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (E,2R)-2-(trifluoromethyl)oct-3-ene-1,2-diol |
| SMILES | CCCC/C=C/[C@@](O)(CO)C(F)(F)F |
| InChI | InChI=1S/C9H15F3O2/c1-2-3-4-5-6-8(14,7-13)9(10,11)12/h5-6,13-14H,2-4,7H2,1H3/b6-5+/t8-/m1/s1 |
| InChIKey | LAIZLRPAHXJJJH-HQZHTGGTSA-N |
| XLogP | 2.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|