C10H15F3O2 — CID 90721431
(2R,3S)-6-(trifluoromethyl)nona-5,8-diene-2,3-diol (PubChem CID 90721431) has the molecular formula C10H15F3O2 and a molecular weight of 224.22 g/mol. Its IUPAC name is (2R,3S)-6-(trifluoromethyl)nona-5,8-diene-2,3-diol.
| Compound Name | (2R,3S)-6-(trifluoromethyl)nona-5,8-diene-2,3-diol |
|---|---|
| PubChem CID | 90721431 |
| Molecular Formula | C10H15F3O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (2R,3S)-6-(trifluoromethyl)nona-5,8-diene-2,3-diol |
| SMILES | C=CCC(=CC[C@H](O)[C@@H](C)O)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O2/c1-3-4-8(10(11,12)13)5-6-9(15)7(2)14/h3,5,7,9,14-15H,1,4,6H2,2H3/t7-,9+/m1/s1 |
| InChIKey | LJNBHTMBYYNEAK-APPZFPTMSA-N |
| XLogP | 2.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|