C15H23N — CID 134965391
(1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulene-1-carbonitrile (PubChem CID 134965391) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is (1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulene-1-carbonitrile.
| Compound Name | (1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulene-1-carbonitrile |
|---|---|
| PubChem CID | 134965391 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | (1R,3aR,8aS)-1,4,4-trimethyl-8-methylidene-3,3a,5,6,7,8a-hexahydro-2H-azulene-1-carbonitrile |
| SMILES | C=C1CCCC(C)(C)[C@@H]2CC[C@@](C)(C#N)[C@H]12 |
| InChI | InChI=1S/C15H23N/c1-11-6-5-8-14(2,3)12-7-9-15(4,10-16)13(11)12/h12-13H,1,5-9H2,2-4H3/t12-,13-,15+/m1/s1 |
| InChIKey | VLHIFZSLHKJPSK-NFAWXSAZSA-N |
| XLogP | 4.31 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|