C14H11O3- — CID 134966397
6,7-dimethoxycyclopenta[a]inden-4-olate (PubChem CID 134966397) has the molecular formula C14H11O3- and a molecular weight of 227.24 g/mol. Its IUPAC name is 6,7-dimethoxycyclopenta[a]inden-4-olate.
| Compound Name | 6,7-dimethoxycyclopenta[a]inden-4-olate |
|---|---|
| PubChem CID | 134966397 |
| Molecular Formula | C14H11O3- |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 6,7-dimethoxycyclopenta[a]inden-4-olate |
| SMILES | COc1cc2c(cc1OC)=C1C=CC=C1C=2[O-] |
| InChI | InChI=1S/C14H12O3/c1-16-12-6-10-8-4-3-5-9(8)14(15)11(10)7-13(12)17-2/h3-7,15H,1-2H3/p-1 |
| InChIKey | ZDYIXAOZBVPHOO-UHFFFAOYSA-M |
| XLogP | -0.17 |
| TPSA | 41.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |