C9H12O2 — CID 85112621
1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene (PubChem CID 85112621) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene.
| Compound Name | 1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene |
|---|---|
| PubChem CID | 85112621 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 1,3-dimethoxy-5-methylidenecyclohexa-1,3-diene |
| SMILES | C=C1C=C(OC)C=C(OC)C1 |
| InChI | InChI=1S/C9H12O2/c1-7-4-8(10-2)6-9(5-7)11-3/h4,6H,1,5H2,2-3H3 |
| InChIKey | WCSYUPLGVUEZHI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |