C9H15NO2 — CID 134966926
2-[(1S,5R)-2,5-dimethylcyclopent-2-en-1-yl]-N-hydroxyacetamide (PubChem CID 134966926) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 2-[(1S,5R)-2,5-dimethylcyclopent-2-en-1-yl]-N-hydroxyacetamide.
| Compound Name | 2-[(1S,5R)-2,5-dimethylcyclopent-2-en-1-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 134966926 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 2-[(1S,5R)-2,5-dimethylcyclopent-2-en-1-yl]-N-hydroxyacetamide |
| SMILES | CC1=CC[C@@H](C)[C@@H]1CC(=O)NO |
| InChI | InChI=1S/C9H15NO2/c1-6-3-4-7(2)8(6)5-9(11)10-12/h3,7-8,12H,4-5H2,1-2H3,(H,10,11)/t7-,8-/m1/s1 |
| InChIKey | PMJKQNDQHNKCKB-HTQZYQBOSA-N |
| XLogP | 1.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|