C15H22O2 — CID 134968808
(5S)-8-[(1R)-1-hydroxyprop-2-enyl]-5-methyl-2-prop-1-en-2-ylbicyclo[3.2.1]octan-6-one (PubChem CID 134968808) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (5S)-8-[(1R)-1-hydroxyprop-2-enyl]-5-methyl-2-prop-1-en-2-ylbicyclo[3.2.1]octan-6-one.
| Compound Name | (5S)-8-[(1R)-1-hydroxyprop-2-enyl]-5-methyl-2-prop-1-en-2-ylbicyclo[3.2.1]octan-6-one |
|---|---|
| PubChem CID | 134968808 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (5S)-8-[(1R)-1-hydroxyprop-2-enyl]-5-methyl-2-prop-1-en-2-ylbicyclo[3.2.1]octan-6-one |
| SMILES | C=CC(O)C1C2CC(=O)[C@@]1(C)CCC2C(=C)C |
| InChI | InChI=1S/C15H22O2/c1-5-12(16)14-11-8-13(17)15(14,4)7-6-10(11)9(2)3/h5,10-12,14,16H,1-2,6-8H2,3-4H3/t10?,11?,12?,14?,15-/m1/s1 |
| InChIKey | PQPGGGMJEIMWCR-FNAKGOALSA-N |
| XLogP | 2.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|