C13H18O2 — CID 44541799
(1R,4R,5R)-5-(hydroxymethyl)-7-methylidene-4-prop-2-enylbicyclo[3.2.1]octan-2-one (PubChem CID 44541799) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (1R,4R,5R)-5-(hydroxymethyl)-7-methylidene-4-prop-2-enylbicyclo[3.2.1]octan-2-one.
| Compound Name | (1R,4R,5R)-5-(hydroxymethyl)-7-methylidene-4-prop-2-enylbicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 44541799 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (1R,4R,5R)-5-(hydroxymethyl)-7-methylidene-4-prop-2-enylbicyclo[3.2.1]octan-2-one |
| SMILES | C=CC[C@@H]1CC(=O)[C@@H]2C[C@@]1(CO)CC2=C |
| InChI | InChI=1S/C13H18O2/c1-3-4-10-5-12(15)11-7-13(10,8-14)6-9(11)2/h3,10-11,14H,1-2,4-8H2/t10-,11-,13-/m1/s1 |
| InChIKey | SUIBIJKFZFZKRL-NQBHXWOUSA-N |
| XLogP | 2.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|