C25H42O5SSi — CID 134969822
[(2S)-2-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate (PubChem CID 134969822) has the molecular formula C25H42O5SSi and a molecular weight of 482.76 g/mol. Its IUPAC name is [(2S)-2-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134969822 |
| Molecular Formula | C25H42O5SSi |
| Molecular Weight | 482.76 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | [(2S)-2-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-2-hydroxyethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)C2CC[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]23C)cc1 |
| InChI | InChI=1S/C25H42O5SSi/c1-18-10-12-19(13-11-18)31(27,28)29-17-22(26)20-14-15-21-23(9-8-16-25(20,21)5)30-32(6,7)24(2,3)4/h10-13,20-23,26H,8-9,14-17H2,1-7H3/t20?,21-,22+,23-,25+/m0/s1 |
| InChIKey | NELSNNOBHYXUHV-KYBKRXRWSA-N |
| XLogP | 5.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.76 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|