C15H19NO3Si — CID 134970255
1-methoxy-9b-trimethylsilyloxy-3H-pyrrolo[2,1-a]isoindol-5-one (PubChem CID 134970255) has the molecular formula C15H19NO3Si and a molecular weight of 289.41 g/mol. Its IUPAC name is 1-methoxy-9b-trimethylsilyloxy-3H-pyrrolo[2,1-a]isoindol-5-one.
| Compound Name | 1-methoxy-9b-trimethylsilyloxy-3H-pyrrolo[2,1-a]isoindol-5-one |
|---|---|
| PubChem CID | 134970255 |
| Molecular Formula | C15H19NO3Si |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-methoxy-9b-trimethylsilyloxy-3H-pyrrolo[2,1-a]isoindol-5-one |
| SMILES | COC1=CCN2C(=O)c3ccccc3C12O[Si](C)(C)C |
| InChI | InChI=1S/C15H19NO3Si/c1-18-13-9-10-16-14(17)11-7-5-6-8-12(11)15(13,16)19-20(2,3)4/h5-9H,10H2,1-4H3 |
| InChIKey | UPESJOODNGCUIZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|