C17H23NO4S — CID 134971228
(3R)-3-hydroxy-4-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]butan-1-one (PubChem CID 134971228) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is (3R)-3-hydroxy-4-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]butan-1-one.
| Compound Name | (3R)-3-hydroxy-4-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 134971228 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (3R)-3-hydroxy-4-phenylmethoxy-1-[(4S)-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]butan-1-one |
| SMILES | CC(C)[C@H]1COC(=S)N1C(=O)C[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C17H23NO4S/c1-12(2)15-11-22-17(23)18(15)16(20)8-14(19)10-21-9-13-6-4-3-5-7-13/h3-7,12,14-15,19H,8-11H2,1-2H3/t14-,15-/m1/s1 |
| InChIKey | IOJDKOXGKVDGMG-HUUCEWRRSA-N |
| XLogP | 2.12 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|