C21H33O4+ — CID 134973611
methyl (Z,2S,4S)-2-acetyloxy-4-methyl-2-[(1S)-1-methylcyclopent-2-en-1-yl]undec-6-enoate (PubChem CID 134973611) has the molecular formula C21H33O4+ and a molecular weight of 349.49 g/mol. Its IUPAC name is methyl (Z,2S,4S)-2-acetyloxy-4-methyl-2-[(1S)-1-methylcyclopent-2-en-1-yl]undec-6-enoate.
| Compound Name | methyl (Z,2S,4S)-2-acetyloxy-4-methyl-2-[(1S)-1-methylcyclopent-2-en-1-yl]undec-6-enoate |
|---|---|
| PubChem CID | 134973611 |
| Molecular Formula | C21H33O4+ |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | methyl (Z,2S,4S)-2-acetyloxy-4-methyl-2-[(1S)-1-methylcyclopent-2-en-1-yl]undec-6-enoate |
| SMILES | CCCC/C=C\C[C@H](C)C[C@@](OC(C)=O)(C(=O)OC)[C@]1(C)C=C[CH+]C1 |
| InChI | InChI=1S/C21H33O4/c1-6-7-8-9-10-13-17(2)16-21(19(23)24-5,25-18(3)22)20(4)14-11-12-15-20/h9-12,14,17H,6-8,13,15-16H2,1-5H3/q+1/b10-9-/t17-,20+,21+/m0/s1 |
| InChIKey | IJYPEZSBZKKSLZ-PMIISDCWSA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|