C20H34O5 — CID 10594290
tert-butyl 2-[2-[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]ethoxy]ethoxy]acetate (PubChem CID 10594290) has the molecular formula C20H34O5 and a molecular weight of 354.49 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]ethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 10594290 |
| Molecular Formula | C20H34O5 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | tert-butyl 2-[2-[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]ethoxy]ethoxy]acetate |
| SMILES | CC/C=C\C[C@H]1C(=O)CC[C@@H]1CCOCCOCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H34O5/c1-5-6-7-8-17-16(9-10-18(17)21)11-12-23-13-14-24-15-19(22)25-20(2,3)4/h6-7,16-17H,5,8-15H2,1-4H3/b7-6-/t16-,17-/m1/s1 |
| InChIKey | FZOGMZLTMHTIRT-TZNMXKOXSA-N |
| XLogP | 3.70 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|