C24H39FO5 — CID 57072275
ethyl 8-[(1R,2R)-2-[4-(fluoromethyl)-4-hydroxyoct-1-enyl]-5-oxocyclopentyl]-2-oxooctanoate (PubChem CID 57072275) has the molecular formula C24H39FO5 and a molecular weight of 426.57 g/mol. Its IUPAC name is ethyl 8-[(1R,2R)-2-[4-(fluoromethyl)-4-hydroxyoct-1-enyl]-5-oxocyclopentyl]-2-oxooctanoate.
| Compound Name | ethyl 8-[(1R,2R)-2-[4-(fluoromethyl)-4-hydroxyoct-1-enyl]-5-oxocyclopentyl]-2-oxooctanoate |
|---|---|
| PubChem CID | 57072275 |
| Molecular Formula | C24H39FO5 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | ethyl 8-[(1R,2R)-2-[4-(fluoromethyl)-4-hydroxyoct-1-enyl]-5-oxocyclopentyl]-2-oxooctanoate |
| SMILES | CCCCC(O)(CF)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)C(=O)OCC |
| InChI | InChI=1S/C24H39FO5/c1-3-5-16-24(29,18-25)17-10-11-19-14-15-21(26)20(19)12-8-6-7-9-13-22(27)23(28)30-4-2/h10-11,19-20,29H,3-9,12-18H2,1-2H3/t19-,20+,24?/m0/s1 |
| InChIKey | PKJMCAUTKUTAGA-ZPVKFHTISA-N |
| XLogP | 4.89 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|