C21H35FO4 — CID 54093746
2-(fluoromethoxy)-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]heptanoic acid (PubChem CID 54093746) has the molecular formula C21H35FO4 and a molecular weight of 370.51 g/mol. Its IUPAC name is 2-(fluoromethoxy)-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]heptanoic acid.
| Compound Name | 2-(fluoromethoxy)-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 54093746 |
| Molecular Formula | C21H35FO4 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 2-(fluoromethoxy)-7-[(1R,2R)-2-oct-1-enyl-5-oxocyclopentyl]heptanoic acid |
| SMILES | CCCCCCC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(OCF)C(=O)O |
| InChI | InChI=1S/C21H35FO4/c1-2-3-4-5-6-8-11-17-14-15-19(23)18(17)12-9-7-10-13-20(21(24)25)26-16-22/h8,11,17-18,20H,2-7,9-10,12-16H2,1H3,(H,24,25)/t17-,18+,20?/m0/s1 |
| InChIKey | MVQODBHNHZVAGH-IVAAQHKWSA-N |
| XLogP | 5.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|