C22H35FO4 — CID 54059130
ethyl 2-fluoro-2-hydroxy-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoate (PubChem CID 54059130) has the molecular formula C22H35FO4 and a molecular weight of 382.52 g/mol. Its IUPAC name is ethyl 2-fluoro-2-hydroxy-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoate.
| Compound Name | ethyl 2-fluoro-2-hydroxy-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoate |
|---|---|
| PubChem CID | 54059130 |
| Molecular Formula | C22H35FO4 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | ethyl 2-fluoro-2-hydroxy-7-[(1R,2R)-2-octa-1,5-dienyl-5-oxocyclopentyl]heptanoate |
| SMILES | CCC=CCCC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(O)(F)C(=O)OCC |
| InChI | InChI=1S/C22H35FO4/c1-3-5-6-7-8-10-13-18-15-16-20(24)19(18)14-11-9-12-17-22(23,26)21(25)27-4-2/h5-6,10,13,18-19,26H,3-4,7-9,11-12,14-17H2,1-2H3/t18-,19+,22?/m0/s1 |
| InChIKey | LYJYWEKHCTZMDP-ZKTCVHQMSA-N |
| XLogP | 5.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|