C24H42O5 — CID 54435953
methyl (2R,3R)-2-cyclopentyl-2,11-dihydroxy-3-(6-hydroxy-2-methylhex-3-en-2-yl)undec-4-enoate (PubChem CID 54435953) has the molecular formula C24H42O5 and a molecular weight of 410.60 g/mol. Its IUPAC name is methyl (2R,3R)-2-cyclopentyl-2,11-dihydroxy-3-(6-hydroxy-2-methylhex-3-en-2-yl)undec-4-enoate.
| Compound Name | methyl (2R,3R)-2-cyclopentyl-2,11-dihydroxy-3-(6-hydroxy-2-methylhex-3-en-2-yl)undec-4-enoate |
|---|---|
| PubChem CID | 54435953 |
| Molecular Formula | C24H42O5 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.30 |
| IUPAC Name | methyl (2R,3R)-2-cyclopentyl-2,11-dihydroxy-3-(6-hydroxy-2-methylhex-3-en-2-yl)undec-4-enoate |
| SMILES | COC(=O)[C@@](O)(C1CCCC1)[C@H](C=CCCCCCCO)C(C)(C)C=CCCO |
| InChI | InChI=1S/C24H42O5/c1-23(2,17-11-13-19-26)21(16-8-6-4-5-7-12-18-25)24(28,22(27)29-3)20-14-9-10-15-20/h8,11,16-17,20-21,25-26,28H,4-7,9-10,12-15,18-19H2,1-3H3/t21-,24-/m1/s1 |
| InChIKey | WKSSDCKZPJOTSU-ZJSXRUAMSA-N |
| XLogP | 4.16 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|