C21H37FO4 — CID 54227316
2-(fluoromethoxy)-7-[(1R,2S,5R)-2-hydroxy-5-oct-1-enylcyclopentyl]heptanoic acid (PubChem CID 54227316) has the molecular formula C21H37FO4 and a molecular weight of 372.52 g/mol. Its IUPAC name is 2-(fluoromethoxy)-7-[(1R,2S,5R)-2-hydroxy-5-oct-1-enylcyclopentyl]heptanoic acid.
| Compound Name | 2-(fluoromethoxy)-7-[(1R,2S,5R)-2-hydroxy-5-oct-1-enylcyclopentyl]heptanoic acid |
|---|---|
| PubChem CID | 54227316 |
| Molecular Formula | C21H37FO4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 2-(fluoromethoxy)-7-[(1R,2S,5R)-2-hydroxy-5-oct-1-enylcyclopentyl]heptanoic acid |
| SMILES | CCCCCCC=C[C@H]1CC[C@H](O)[C@@H]1CCCCCC(OCF)C(=O)O |
| InChI | InChI=1S/C21H37FO4/c1-2-3-4-5-6-8-11-17-14-15-19(23)18(17)12-9-7-10-13-20(21(24)25)26-16-22/h8,11,17-20,23H,2-7,9-10,12-16H2,1H3,(H,24,25)/t17-,18+,19-,20?/m0/s1 |
| InChIKey | QGTPBRKWTOOULI-COHPWVSRSA-N |
| XLogP | 5.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|