C24H39FO5 — CID 54184866
methyl 7-[(1R,2R)-2-[(3R)-3-[1-(4-fluorobutyl)cyclobutyl]-3-hydroxyprop-1-enyl]-5-oxocyclopentyl]-2-hydroxyheptanoate (PubChem CID 54184866) has the molecular formula C24H39FO5 and a molecular weight of 426.57 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-[(3R)-3-[1-(4-fluorobutyl)cyclobutyl]-3-hydroxyprop-1-enyl]-5-oxocyclopentyl]-2-hydroxyheptanoate.
| Compound Name | methyl 7-[(1R,2R)-2-[(3R)-3-[1-(4-fluorobutyl)cyclobutyl]-3-hydroxyprop-1-enyl]-5-oxocyclopentyl]-2-hydroxyheptanoate |
|---|---|
| PubChem CID | 54184866 |
| Molecular Formula | C24H39FO5 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | methyl 7-[(1R,2R)-2-[(3R)-3-[1-(4-fluorobutyl)cyclobutyl]-3-hydroxyprop-1-enyl]-5-oxocyclopentyl]-2-hydroxyheptanoate |
| SMILES | COC(=O)C(O)CCCCC[C@H]1C(=O)CC[C@@H]1C=C[C@@H](O)C1(CCCCF)CCC1 |
| InChI | InChI=1S/C24H39FO5/c1-30-23(29)21(27)9-4-2-3-8-19-18(10-12-20(19)26)11-13-22(28)24(15-7-16-24)14-5-6-17-25/h11,13,18-19,21-22,27-28H,2-10,12,14-17H2,1H3/t18-,19-,21?,22-/m1/s1 |
| InChIKey | PEJXQPISYLNDQQ-ZDDFIPATSA-N |
| XLogP | 4.29 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|