C23H38O5 — CID 70596212
methyl 7-[(1R,5R)-2-oxo-5-[2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]cyclopentyl]heptanoate (PubChem CID 70596212) has the molecular formula C23H38O5 and a molecular weight of 394.55 g/mol. Its IUPAC name is methyl 7-[(1R,5R)-2-oxo-5-[2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,5R)-2-oxo-5-[2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70596212 |
| Molecular Formula | C23H38O5 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | methyl 7-[(1R,5R)-2-oxo-5-[2-(2-pentyl-1,3-dioxolan-2-yl)ethenyl]cyclopentyl]heptanoate |
| SMILES | CCCCCC1(C=C[C@H]2CCC(=O)[C@@H]2CCCCCCC(=O)OC)OCCO1 |
| InChI | InChI=1S/C23H38O5/c1-3-4-9-15-23(27-17-18-28-23)16-14-19-12-13-21(24)20(19)10-7-5-6-8-11-22(25)26-2/h14,16,19-20H,3-13,15,17-18H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | BHTQIEPWYATEOK-WOJBJXKFSA-N |
| XLogP | 4.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|