C26H42O5 — CID 56606103
methyl (2R)-2-acetyloxy-7-[(1R,2S,3R)-2-(4,4-dimethyloct-1-enyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate (PubChem CID 56606103) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is methyl (2R)-2-acetyloxy-7-[(1R,2S,3R)-2-(4,4-dimethyloct-1-enyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | methyl (2R)-2-acetyloxy-7-[(1R,2S,3R)-2-(4,4-dimethyloct-1-enyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 56606103 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | methyl (2R)-2-acetyloxy-7-[(1R,2S,3R)-2-(4,4-dimethyloct-1-enyl)-3-methyl-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCC(C)(C)CC=C[C@@H]1[C@H](C)CC(=O)[C@@H]1CC=CCC[C@@H](OC(C)=O)C(=O)OC |
| InChI | InChI=1S/C26H42O5/c1-7-8-16-26(4,5)17-12-14-21-19(2)18-23(28)22(21)13-10-9-11-15-24(25(29)30-6)31-20(3)27/h9-10,12,14,19,21-22,24H,7-8,11,13,15-18H2,1-6H3/t19-,21-,22-,24-/m1/s1 |
| InChIKey | BXLWBGYBSWEKTL-VDEHWKIFSA-N |
| XLogP | 5.82 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|