C22H36O5 — CID 54256633
methyl 7-[(1R,2R)-2-(5-ethoxy-4,4-dimethylpent-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate (PubChem CID 54256633) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-(5-ethoxy-4,4-dimethylpent-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate.
| Compound Name | methyl 7-[(1R,2R)-2-(5-ethoxy-4,4-dimethylpent-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate |
|---|---|
| PubChem CID | 54256633 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | methyl 7-[(1R,2R)-2-(5-ethoxy-4,4-dimethylpent-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate |
| SMILES | CCOCC(C)(C)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(=O)C(=O)OC |
| InChI | InChI=1S/C22H36O5/c1-5-27-16-22(2,3)15-9-10-17-13-14-19(23)18(17)11-7-6-8-12-20(24)21(25)26-4/h9-10,17-18H,5-8,11-16H2,1-4H3/t17-,18+/m0/s1 |
| InChIKey | RANLHMHQFNWXAC-ZWKOTPCHSA-N |
| XLogP | 4.28 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|