C24H38F2O5 — CID 57018289
ethyl 8-[(1R,2R)-2-[4-(difluoromethyl)-4-hydroxyoct-1-enyl]-5-oxocyclopentyl]-2-oxooctanoate (PubChem CID 57018289) has the molecular formula C24H38F2O5 and a molecular weight of 444.56 g/mol. Its IUPAC name is ethyl 8-[(1R,2R)-2-[4-(difluoromethyl)-4-hydroxyoct-1-enyl]-5-oxocyclopentyl]-2-oxooctanoate.
| Compound Name | ethyl 8-[(1R,2R)-2-[4-(difluoromethyl)-4-hydroxyoct-1-enyl]-5-oxocyclopentyl]-2-oxooctanoate |
|---|---|
| PubChem CID | 57018289 |
| Molecular Formula | C24H38F2O5 |
| Molecular Weight | 444.56 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | ethyl 8-[(1R,2R)-2-[4-(difluoromethyl)-4-hydroxyoct-1-enyl]-5-oxocyclopentyl]-2-oxooctanoate |
| SMILES | CCCCC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CCCCCCC(=O)C(=O)OCC)C(F)F |
| InChI | InChI=1S/C24H38F2O5/c1-3-5-16-24(30,23(25)26)17-10-11-18-14-15-20(27)19(18)12-8-6-7-9-13-21(28)22(29)31-4-2/h10-11,18-19,23,30H,3-9,12-17H2,1-2H3/t18-,19+,24?/m0/s1 |
| InChIKey | JMAQDQPPUOVZLE-ZJWBFHOUSA-N |
| XLogP | 5.19 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|