C17H26O3 — CID 134973657
methyl (1R)-6,6,7-trimethyl-1-(3-oxoprop-1-en-2-yl)-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate (PubChem CID 134973657) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl (1R)-6,6,7-trimethyl-1-(3-oxoprop-1-en-2-yl)-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate.
| Compound Name | methyl (1R)-6,6,7-trimethyl-1-(3-oxoprop-1-en-2-yl)-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate |
|---|---|
| PubChem CID | 134973657 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl (1R)-6,6,7-trimethyl-1-(3-oxoprop-1-en-2-yl)-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate |
| SMILES | C=C(C=O)[C@@H]1CCC2(C(=O)OC)CCC(C)(C)C(C)C12 |
| InChI | InChI=1S/C17H26O3/c1-11(10-18)13-6-7-17(15(19)20-5)9-8-16(3,4)12(2)14(13)17/h10,12-14H,1,6-9H2,2-5H3/t12?,13-,14?,17?/m0/s1 |
| InChIKey | HHEPDSYEGOKOJZ-UHKZTBIMSA-N |
| XLogP | 3.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|