C34H62O7 — CID 134973879
(2R,3S,6S)-2,3,4,5-tetramethyl-6-[(2S,5R)-2,5,6-trimethyl-4-[(2S,5R)-3,5,6-trimethyl-4-[(2S,5S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxan-2-yl]oxyoxan-3-yl]oxyoxane (PubChem CID 134973879) has the molecular formula C34H62O7 and a molecular weight of 582.86 g/mol. Its IUPAC name is (2R,3S,6S)-2,3,4,5-tetramethyl-6-[(2S,5R)-2,5,6-trimethyl-4-[(2S,5R)-3,5,6-trimethyl-4-[(2S,5S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxan-2-yl]oxyoxan-3-yl]oxyoxane.
| Compound Name | (2R,3S,6S)-2,3,4,5-tetramethyl-6-[(2S,5R)-2,5,6-trimethyl-4-[(2S,5R)-3,5,6-trimethyl-4-[(2S,5S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxan-2-yl]oxyoxan-3-yl]oxyoxane |
|---|---|
| PubChem CID | 134973879 |
| Molecular Formula | C34H62O7 |
| Molecular Weight | 582.86 g/mol |
| Exact Mass | 582.45 |
| IUPAC Name | (2R,3S,6S)-2,3,4,5-tetramethyl-6-[(2S,5R)-2,5,6-trimethyl-4-[(2S,5R)-3,5,6-trimethyl-4-[(2S,5S)-3,4,5,6-tetramethyloxan-2-yl]oxyoxan-2-yl]oxyoxan-3-yl]oxyoxane |
| SMILES | CC1C(C)[C@H](C)C(C)O[C@H]1OC1C(C)[C@H](OC2C(O[C@@H]3O[C@H](C)[C@@H](C)C(C)C3C)[C@H](C)OC(C)[C@H]2C)OC(C)[C@H]1C |
| InChI | InChI=1S/C34H62O7/c1-15-17(3)24(10)36-32(19(15)5)39-29-21(7)27(13)38-34(23(29)9)40-30-22(8)26(12)35-28(14)31(30)41-33-20(6)16(2)18(4)25(11)37-33/h15-34H,1-14H3/t15?,16?,17-,18-,19?,20?,21+,22+,23?,24?,25+,26?,27?,28-,29?,30?,31?,32-,33-,34-/m0/s1 |
| InChIKey | SFNSJPKDQGBNKA-PKTSQYANSA-N |
| XLogP | 6.91 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.86 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |