C34H62O8 — CID 134973459
(3R,6S)-4-[(2S,5R)-4-methoxy-3,5,6-trimethyloxan-2-yl]oxy-2,3,5-trimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxan-4-yl]oxyoxane (PubChem CID 134973459) has the molecular formula C34H62O8 and a molecular weight of 598.86 g/mol. Its IUPAC name is (3R,6S)-4-[(2S,5R)-4-methoxy-3,5,6-trimethyloxan-2-yl]oxy-2,3,5-trimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxan-4-yl]oxyoxane.
| Compound Name | (3R,6S)-4-[(2S,5R)-4-methoxy-3,5,6-trimethyloxan-2-yl]oxy-2,3,5-trimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxan-4-yl]oxyoxane |
|---|---|
| PubChem CID | 134973459 |
| Molecular Formula | C34H62O8 |
| Molecular Weight | 598.86 g/mol |
| Exact Mass | 598.44 |
| IUPAC Name | (3R,6S)-4-[(2S,5R)-4-methoxy-3,5,6-trimethyloxan-2-yl]oxy-2,3,5-trimethyl-6-[(3R,6S)-2,3,5-trimethyl-6-[(3R)-2,3,5,6-tetramethyloxan-4-yl]oxyoxan-4-yl]oxyoxane |
| SMILES | COC1C(C)[C@H](OC2C(C)[C@H](OC3C(C)[C@H](OC4C(C)C(C)OC(C)[C@H]4C)OC(C)[C@H]3C)OC(C)[C@H]2C)OC(C)[C@H]1C |
| InChI | InChI=1S/C34H62O8/c1-15-25(11)37-32(20(6)28(15)35-14)41-30-18(4)27(13)39-34(22(30)8)42-31-19(5)26(12)38-33(21(31)7)40-29-16(2)23(9)36-24(10)17(29)3/h15-34H,1-14H3/t15-,16-,17?,18-,19-,20?,21?,22?,23?,24?,25?,26?,27?,28?,29?,30?,31?,32+,33+,34+/m1/s1 |
| InChIKey | MFCJGYUODWIATC-CTNXORGKSA-N |
| XLogP | 6.29 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.86 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |