C23H32OSSi — CID 134975293
(2-hydroxysulfanyl-4,4-dimethyl-1,1-diphenylhex-5-en-3-yl)-trimethylsilane (PubChem CID 134975293) has the molecular formula C23H32OSSi and a molecular weight of 384.66 g/mol. Its IUPAC name is (2-hydroxysulfanyl-4,4-dimethyl-1,1-diphenylhex-5-en-3-yl)-trimethylsilane.
| Compound Name | (2-hydroxysulfanyl-4,4-dimethyl-1,1-diphenylhex-5-en-3-yl)-trimethylsilane |
|---|---|
| PubChem CID | 134975293 |
| Molecular Formula | C23H32OSSi |
| Molecular Weight | 384.66 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | (2-hydroxysulfanyl-4,4-dimethyl-1,1-diphenylhex-5-en-3-yl)-trimethylsilane |
| SMILES | C=CC(C)(C)C(C(SO)C(c1ccccc1)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C23H32OSSi/c1-7-23(2,3)22(26(4,5)6)21(25-24)20(18-14-10-8-11-15-18)19-16-12-9-13-17-19/h7-17,20-22,24H,1H2,2-6H3 |
| InChIKey | VKDNSRSOTCBFKE-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.66 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|