C12H16O4P- — CID 134976075
ethoxy-(5-ethoxycarbonyl-3,4-dimethylphosphol-2-ylidene)methanolate (PubChem CID 134976075) has the molecular formula C12H16O4P- and a molecular weight of 255.23 g/mol. Its IUPAC name is ethoxy-(5-ethoxycarbonyl-3,4-dimethylphosphol-2-ylidene)methanolate.
| Compound Name | ethoxy-(5-ethoxycarbonyl-3,4-dimethylphosphol-2-ylidene)methanolate |
|---|---|
| PubChem CID | 134976075 |
| Molecular Formula | C12H16O4P- |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | ethoxy-(5-ethoxycarbonyl-3,4-dimethylphosphol-2-ylidene)methanolate |
| SMILES | CCOC(=O)C1=PC(=C([O-])OCC)C(C)=C1C |
| InChI | InChI=1S/C12H17O4P/c1-5-15-11(13)9-7(3)8(4)10(17-9)12(14)16-6-2/h13H,5-6H2,1-4H3/p-1 |
| InChIKey | GXXNOQWQCAIBIJ-UHFFFAOYSA-M |
| XLogP | 1.58 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|