C13H22O4Si — CID 134980126
(3S,3aR,7R,7aR)-7-methoxy-3-methyl-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 134980126) has the molecular formula C13H22O4Si and a molecular weight of 270.40 g/mol. Its IUPAC name is (3S,3aR,7R,7aR)-7-methoxy-3-methyl-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3S,3aR,7R,7aR)-7-methoxy-3-methyl-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 134980126 |
| Molecular Formula | C13H22O4Si |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (3S,3aR,7R,7aR)-7-methoxy-3-methyl-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | CO[C@@H]1C=C(O[Si](C)(C)C)C[C@@H]2[C@H]1C(=O)O[C@H]2C |
| InChI | InChI=1S/C13H22O4Si/c1-8-10-6-9(17-18(3,4)5)7-11(15-2)12(10)13(14)16-8/h7-8,10-12H,6H2,1-5H3/t8-,10-,11+,12+/m0/s1 |
| InChIKey | PRLCBKSXGIBBLZ-OHBODLIOSA-N |
| XLogP | 2.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|