C14H22O5Si — CID 134980021
methyl (3S,3aR,7R,7aR)-3-methyl-1-oxo-7-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate (PubChem CID 134980021) has the molecular formula C14H22O5Si and a molecular weight of 298.41 g/mol. Its IUPAC name is methyl (3S,3aR,7R,7aR)-3-methyl-1-oxo-7-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate.
| Compound Name | methyl (3S,3aR,7R,7aR)-3-methyl-1-oxo-7-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 134980021 |
| Molecular Formula | C14H22O5Si |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | methyl (3S,3aR,7R,7aR)-3-methyl-1-oxo-7-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate |
| SMILES | COC(=O)C1C=C[C@@H](O[Si](C)(C)C)[C@@H]2C(=O)O[C@@H](C)[C@H]12 |
| InChI | InChI=1S/C14H22O5Si/c1-8-11-9(13(15)17-2)6-7-10(19-20(3,4)5)12(11)14(16)18-8/h6-12H,1-5H3/t8-,9?,10+,11+,12-/m0/s1 |
| InChIKey | PTOMUGGMQDQYLN-SRNJKDFUSA-N |
| XLogP | 1.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|