C15H24O5Si — CID 134979639
methyl (3S,3aS,7R,7aS)-3,7-dimethyl-1-oxo-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate (PubChem CID 134979639) has the molecular formula C15H24O5Si and a molecular weight of 312.44 g/mol. Its IUPAC name is methyl (3S,3aS,7R,7aS)-3,7-dimethyl-1-oxo-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate.
| Compound Name | methyl (3S,3aS,7R,7aS)-3,7-dimethyl-1-oxo-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 134979639 |
| Molecular Formula | C15H24O5Si |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | methyl (3S,3aS,7R,7aS)-3,7-dimethyl-1-oxo-5-trimethylsilyloxy-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate |
| SMILES | COC(=O)C1C(O[Si](C)(C)C)=C[C@@H](C)[C@@H]2C(=O)O[C@@H](C)[C@H]12 |
| InChI | InChI=1S/C15H24O5Si/c1-8-7-10(20-21(4,5)6)13(14(16)18-3)12-9(2)19-15(17)11(8)12/h7-9,11-13H,1-6H3/t8-,9+,11+,12+,13?/m1/s1 |
| InChIKey | QRKBWRDXFMPKQO-LCPKSDKKSA-N |
| XLogP | 2.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|