C15H28O4Si2 — CID 134980398
(3S,3aR,7R,7aR)-3-methyl-5,7-bis(trimethylsilyloxy)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 134980398) has the molecular formula C15H28O4Si2 and a molecular weight of 328.56 g/mol. Its IUPAC name is (3S,3aR,7R,7aR)-3-methyl-5,7-bis(trimethylsilyloxy)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3S,3aR,7R,7aR)-3-methyl-5,7-bis(trimethylsilyloxy)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 134980398 |
| Molecular Formula | C15H28O4Si2 |
| Molecular Weight | 328.56 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | (3S,3aR,7R,7aR)-3-methyl-5,7-bis(trimethylsilyloxy)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | C[C@@H]1OC(=O)[C@@H]2[C@H]1CC(O[Si](C)(C)C)=C[C@H]2O[Si](C)(C)C |
| InChI | InChI=1S/C15H28O4Si2/c1-10-12-8-11(18-20(2,3)4)9-13(19-21(5,6)7)14(12)15(16)17-10/h9-10,12-14H,8H2,1-7H3/t10-,12-,13+,14+/m0/s1 |
| InChIKey | ONMOXHHEDWMNQA-SCUASFONSA-N |
| XLogP | 3.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.56 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|