C17H30O6Si2 — CID 134980399
methyl (3S,3aS,7R,7aR)-3-methyl-1-oxo-5,7-bis(trimethylsilyloxy)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate (PubChem CID 134980399) has the molecular formula C17H30O6Si2 and a molecular weight of 386.59 g/mol. Its IUPAC name is methyl (3S,3aS,7R,7aR)-3-methyl-1-oxo-5,7-bis(trimethylsilyloxy)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate.
| Compound Name | methyl (3S,3aS,7R,7aR)-3-methyl-1-oxo-5,7-bis(trimethylsilyloxy)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 134980399 |
| Molecular Formula | C17H30O6Si2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | methyl (3S,3aS,7R,7aR)-3-methyl-1-oxo-5,7-bis(trimethylsilyloxy)-3a,4,7,7a-tetrahydro-3H-2-benzofuran-4-carboxylate |
| SMILES | COC(=O)C1C(O[Si](C)(C)C)=C[C@@H](O[Si](C)(C)C)[C@@H]2C(=O)O[C@@H](C)[C@H]12 |
| InChI | InChI=1S/C17H30O6Si2/c1-10-13-14(16(18)20-2)11(22-24(3,4)5)9-12(23-25(6,7)8)15(13)17(19)21-10/h9-10,12-15H,1-8H3/t10-,12+,13+,14?,15-/m0/s1 |
| InChIKey | ANIZYGVSFQCCNE-DQGXWQGZSA-N |
| XLogP | 2.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|