C14H22O5Si — CID 14901564
(3aR,4S,7aR)-4-methoxy-3a,7a-dimethyl-6-trimethylsilyloxy-4,7-dihydro-2-benzofuran-1,3-dione (PubChem CID 14901564) has the molecular formula C14H22O5Si and a molecular weight of 298.41 g/mol. Its IUPAC name is (3aR,4S,7aR)-4-methoxy-3a,7a-dimethyl-6-trimethylsilyloxy-4,7-dihydro-2-benzofuran-1,3-dione.
| Compound Name | (3aR,4S,7aR)-4-methoxy-3a,7a-dimethyl-6-trimethylsilyloxy-4,7-dihydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 14901564 |
| Molecular Formula | C14H22O5Si |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (3aR,4S,7aR)-4-methoxy-3a,7a-dimethyl-6-trimethylsilyloxy-4,7-dihydro-2-benzofuran-1,3-dione |
| SMILES | CO[C@H]1C=C(O[Si](C)(C)C)C[C@@]2(C)C(=O)OC(=O)[C@@]12C |
| InChI | InChI=1S/C14H22O5Si/c1-13-8-9(19-20(4,5)6)7-10(17-3)14(13,2)12(16)18-11(13)15/h7,10H,8H2,1-6H3/t10-,13-,14+/m0/s1 |
| InChIKey | OELQXYUDNSEKLU-LEWSCRJBSA-N |
| XLogP | 2.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|