C17H22O2Se — CID 134980322
1-[(1R,2S)-4-methyl-2-(2-phenylselanylethoxy)cyclohex-3-en-1-yl]ethanone (PubChem CID 134980322) has the molecular formula C17H22O2Se and a molecular weight of 337.32 g/mol. Its IUPAC name is 1-[(1R,2S)-4-methyl-2-(2-phenylselanylethoxy)cyclohex-3-en-1-yl]ethanone.
| Compound Name | 1-[(1R,2S)-4-methyl-2-(2-phenylselanylethoxy)cyclohex-3-en-1-yl]ethanone |
|---|---|
| PubChem CID | 134980322 |
| Molecular Formula | C17H22O2Se |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 1-[(1R,2S)-4-methyl-2-(2-phenylselanylethoxy)cyclohex-3-en-1-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CCC(C)=C[C@@H]1OCC[Se]c1ccccc1 |
| InChI | InChI=1S/C17H22O2Se/c1-13-8-9-16(14(2)18)17(12-13)19-10-11-20-15-6-4-3-5-7-15/h3-7,12,16-17H,8-11H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | ZOGQNGQXLKBWMP-IRXDYDNUSA-N |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|