C13H15NS2 — CID 134981351
4-(1,3-dithian-2-yl)-1-methylindole (PubChem CID 134981351) has the molecular formula C13H15NS2 and a molecular weight of 249.40 g/mol. Its IUPAC name is 4-(1,3-dithian-2-yl)-1-methylindole.
| Compound Name | 4-(1,3-dithian-2-yl)-1-methylindole |
|---|---|
| PubChem CID | 134981351 |
| Molecular Formula | C13H15NS2 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 4-(1,3-dithian-2-yl)-1-methylindole |
| SMILES | Cn1ccc2c(C3SCCCS3)cccc21 |
| InChI | InChI=1S/C13H15NS2/c1-14-7-6-10-11(4-2-5-12(10)14)13-15-8-3-9-16-13/h2,4-7,13H,3,8-9H2,1H3 |
| InChIKey | WVLSTXRBNBJEGB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |