C18H20N2O2 — CID 146459301
2-(dimethylaminomethylidene)-5-(1-methylindol-4-yl)cyclohexane-1,3-dione (PubChem CID 146459301) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-(dimethylaminomethylidene)-5-(1-methylindol-4-yl)cyclohexane-1,3-dione.
| Compound Name | 2-(dimethylaminomethylidene)-5-(1-methylindol-4-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 146459301 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-(dimethylaminomethylidene)-5-(1-methylindol-4-yl)cyclohexane-1,3-dione |
| SMILES | CN(C)C=C1C(=O)CC(c2cccc3c2ccn3C)CC1=O |
| InChI | InChI=1S/C18H20N2O2/c1-19(2)11-15-17(21)9-12(10-18(15)22)13-5-4-6-16-14(13)7-8-20(16)3/h4-8,11-12H,9-10H2,1-3H3/b15-11- |
| InChIKey | AXMHEKCOXJFUSA-PTNGSMBKSA-N |
| XLogP | 2.64 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|