C17H24O2 — CID 134981863
(4aR,8aR)-6-cyclohexa-1,3-dien-1-yl-2,2,4a-trimethyl-4,7,8,8a-tetrahydro-1,3-benzodioxine (PubChem CID 134981863) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (4aR,8aR)-6-cyclohexa-1,3-dien-1-yl-2,2,4a-trimethyl-4,7,8,8a-tetrahydro-1,3-benzodioxine.
| Compound Name | (4aR,8aR)-6-cyclohexa-1,3-dien-1-yl-2,2,4a-trimethyl-4,7,8,8a-tetrahydro-1,3-benzodioxine |
|---|---|
| PubChem CID | 134981863 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (4aR,8aR)-6-cyclohexa-1,3-dien-1-yl-2,2,4a-trimethyl-4,7,8,8a-tetrahydro-1,3-benzodioxine |
| SMILES | CC1(C)OC[C@@]2(C)C=C(C3=CC=CCC3)CC[C@H]2O1 |
| InChI | InChI=1S/C17H24O2/c1-16(2)18-12-17(3)11-14(9-10-15(17)19-16)13-7-5-4-6-8-13/h4-5,7,11,15H,6,8-10,12H2,1-3H3/t15-,17-/m1/s1 |
| InChIKey | IIAHBCFKIQIAOF-NVXWUHKLSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |