C19H28O4Si2 — CID 134983020
(1S,8R,9S,13R)-1,8-bis(trimethylsilyl)-11-oxatetracyclo[6.5.1.02,7.09,13]tetradec-2(7)-ene-10,12,14-trione (PubChem CID 134983020) has the molecular formula C19H28O4Si2 and a molecular weight of 376.60 g/mol. Its IUPAC name is (1S,8R,9S,13R)-1,8-bis(trimethylsilyl)-11-oxatetracyclo[6.5.1.02,7.09,13]tetradec-2(7)-ene-10,12,14-trione.
| Compound Name | (1S,8R,9S,13R)-1,8-bis(trimethylsilyl)-11-oxatetracyclo[6.5.1.02,7.09,13]tetradec-2(7)-ene-10,12,14-trione |
|---|---|
| PubChem CID | 134983020 |
| Molecular Formula | C19H28O4Si2 |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (1S,8R,9S,13R)-1,8-bis(trimethylsilyl)-11-oxatetracyclo[6.5.1.02,7.09,13]tetradec-2(7)-ene-10,12,14-trione |
| SMILES | C[Si](C)(C)[C@@]12C(=O)[C@@]([Si](C)(C)C)(C3=C1CCCC3)[C@H]1C(=O)OC(=O)[C@H]12 |
| InChI | InChI=1S/C19H28O4Si2/c1-24(2,3)18-11-9-7-8-10-12(11)19(17(18)22,25(4,5)6)14-13(18)15(20)23-16(14)21/h13-14H,7-10H2,1-6H3/t13-,14+,18-,19+ |
| InChIKey | IVRWDQNCALINPV-SLDRDFCHSA-N |
| XLogP | 3.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|