C22H28 — CID 134983141
4,5,9,10,11,12,13,14-octamethyltricyclo[6.2.2.23,6]tetradeca-1(10),3(14),4,6(13),8,11-hexaene (PubChem CID 134983141) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 4,5,9,10,11,12,13,14-octamethyltricyclo[6.2.2.23,6]tetradeca-1(10),3(14),4,6(13),8,11-hexaene.
| Compound Name | 4,5,9,10,11,12,13,14-octamethyltricyclo[6.2.2.23,6]tetradeca-1(10),3(14),4,6(13),8,11-hexaene |
|---|---|
| PubChem CID | 134983141 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 4,5,9,10,11,12,13,14-octamethyltricyclo[6.2.2.23,6]tetradeca-1(10),3(14),4,6(13),8,11-hexaene |
| SMILES | Cc1c(C)c2c(C)c(C)c1Cc1c(C)c(C)c(c(C)c1C)C2 |
| InChI | InChI=1S/C22H28/c1-11-12(2)20-10-22-17(7)15(5)21(16(6)18(22)8)9-19(11)13(3)14(20)4/h9-10H2,1-8H3 |
| InChIKey | GTPTYVBNNFVSHJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |