C21H23N — CID 157264674
1,2,4,5,6,7,8-heptamethyl-9H-fluorene-3-carbonitrile (PubChem CID 157264674) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 1,2,4,5,6,7,8-heptamethyl-9H-fluorene-3-carbonitrile.
| Compound Name | 1,2,4,5,6,7,8-heptamethyl-9H-fluorene-3-carbonitrile |
|---|---|
| PubChem CID | 157264674 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1,2,4,5,6,7,8-heptamethyl-9H-fluorene-3-carbonitrile |
| SMILES | Cc1c(C)c(C)c2c(c1C)Cc1c(C)c(C)c(C#N)c(C)c1-2 |
| InChI | InChI=1S/C21H23N/c1-10-11(2)15(6)20-17(12(10)3)8-18-13(4)14(5)19(9-22)16(7)21(18)20/h8H2,1-7H3 |
| InChIKey | WQTFRHDNRYRQQD-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |