C15H19N3O8 — CID 134983780
[(2R,3S,4R,5Z,6R)-3,4-diacetyloxy-5-hydroxyimino-6-pyrazol-1-yloxan-2-yl]methyl acetate (PubChem CID 134983780) has the molecular formula C15H19N3O8 and a molecular weight of 369.33 g/mol. Its IUPAC name is [(2R,3S,4R,5Z,6R)-3,4-diacetyloxy-5-hydroxyimino-6-pyrazol-1-yloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5Z,6R)-3,4-diacetyloxy-5-hydroxyimino-6-pyrazol-1-yloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134983780 |
| Molecular Formula | C15H19N3O8 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | [(2R,3S,4R,5Z,6R)-3,4-diacetyloxy-5-hydroxyimino-6-pyrazol-1-yloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cccn2)/C(=N\O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H19N3O8/c1-8(19)23-7-11-13(24-9(2)20)14(25-10(3)21)12(17-22)15(26-11)18-6-4-5-16-18/h4-6,11,13-15,22H,7H2,1-3H3/b17-12-/t11-,13-,14-,15-/m1/s1 |
| InChIKey | ZQMFEHJVYVHGNQ-HEOIWBQBSA-N |
| XLogP | 0.04 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|