C12H17NO8 — CID 173430967
[(2R,3R,4R)-3,4-diacetyloxy-5-hydroxyiminooxan-2-yl]methyl acetate (PubChem CID 173430967) has the molecular formula C12H17NO8 and a molecular weight of 303.27 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-diacetyloxy-5-hydroxyiminooxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R)-3,4-diacetyloxy-5-hydroxyiminooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 173430967 |
| Molecular Formula | C12H17NO8 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | [(2R,3R,4R)-3,4-diacetyloxy-5-hydroxyiminooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OCC(=NO)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H17NO8/c1-6(14)18-5-10-12(21-8(3)16)11(20-7(2)15)9(13-17)4-19-10/h10-12,17H,4-5H2,1-3H3/t10-,11-,12+/m1/s1 |
| InChIKey | GDVOYDODDMVRDW-UTUOFQBUSA-N |
| XLogP | -0.36 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|