C19H29NO2 — CID 134984757
(2S)-2-[(2R)-1-cyclohexyl-3,3-dimethylaziridin-2-yl]-2-phenylmethoxyethanol (PubChem CID 134984757) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (2S)-2-[(2R)-1-cyclohexyl-3,3-dimethylaziridin-2-yl]-2-phenylmethoxyethanol.
| Compound Name | (2S)-2-[(2R)-1-cyclohexyl-3,3-dimethylaziridin-2-yl]-2-phenylmethoxyethanol |
|---|---|
| PubChem CID | 134984757 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (2S)-2-[(2R)-1-cyclohexyl-3,3-dimethylaziridin-2-yl]-2-phenylmethoxyethanol |
| SMILES | CC1(C)[C@H]([C@@H](CO)OCc2ccccc2)N1C1CCCCC1 |
| InChI | InChI=1S/C19H29NO2/c1-19(2)18(20(19)16-11-7-4-8-12-16)17(13-21)22-14-15-9-5-3-6-10-15/h3,5-6,9-10,16-18,21H,4,7-8,11-14H2,1-2H3/t17-,18+,20?/m1/s1 |
| InChIKey | GOIRSHQAOCIPLL-ZOVQDZKKSA-N |
| XLogP | 3.36 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|