C13H19NO3 — CID 134988858
(2E,4E)-6-(1,3-dioxolan-2-yl)-1-pyrrolidin-1-ylhexa-2,4-dien-1-one (PubChem CID 134988858) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (2E,4E)-6-(1,3-dioxolan-2-yl)-1-pyrrolidin-1-ylhexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-6-(1,3-dioxolan-2-yl)-1-pyrrolidin-1-ylhexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 134988858 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (2E,4E)-6-(1,3-dioxolan-2-yl)-1-pyrrolidin-1-ylhexa-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/CC1OCCO1)N1CCCC1 |
| InChI | InChI=1S/C13H19NO3/c15-12(14-8-4-5-9-14)6-2-1-3-7-13-16-10-11-17-13/h1-3,6,13H,4-5,7-11H2/b3-1+,6-2+ |
| InChIKey | OHOSWPGHRCKPQI-DHWRHDBVSA-N |
| XLogP | 1.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|