C31H52O13S2 — CID 134990191
[(3S,4S,5R,6S)-1-butoxy-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]-5,6-bis(methylsulfonyloxy)heptan-3-yl] acetate (PubChem CID 134990191) has the molecular formula C31H52O13S2 and a molecular weight of 696.88 g/mol. Its IUPAC name is [(3S,4S,5R,6S)-1-butoxy-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]-5,6-bis(methylsulfonyloxy)heptan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6S)-1-butoxy-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]-5,6-bis(methylsulfonyloxy)heptan-3-yl] acetate |
|---|---|
| PubChem CID | 134990191 |
| Molecular Formula | C31H52O13S2 |
| Molecular Weight | 696.88 g/mol |
| Exact Mass | 696.28 |
| IUPAC Name | [(3S,4S,5R,6S)-1-butoxy-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]-5,6-bis(methylsulfonyloxy)heptan-3-yl] acetate |
| SMILES | CCCCOCC[C@H](OC(C)=O)[C@H](COCc1ccc(OC)cc1)[C@@H](OS(C)(=O)=O)[C@H](C[C@H]1COC(CC)(CC)O1)OS(C)(=O)=O |
| InChI | InChI=1S/C31H52O13S2/c1-8-11-17-38-18-16-28(41-23(4)32)27(22-39-20-24-12-14-25(37-5)15-13-24)30(44-46(7,35)36)29(43-45(6,33)34)19-26-21-40-31(9-2,10-3)42-26/h12-15,26-30H,8-11,16-22H2,1-7H3/t26-,27-,28-,29-,30+/m0/s1 |
| InChIKey | WIPNSADBQMKYRQ-VFFRCKCKSA-N |
| XLogP | 3.98 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.88 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|