C29H46O7 — CID 134990561
[(Z,3S,4S)-1-butoxy-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]hept-5-en-3-yl] acetate (PubChem CID 134990561) has the molecular formula C29H46O7 and a molecular weight of 506.68 g/mol. Its IUPAC name is [(Z,3S,4S)-1-butoxy-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]hept-5-en-3-yl] acetate.
| Compound Name | [(Z,3S,4S)-1-butoxy-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]hept-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 134990561 |
| Molecular Formula | C29H46O7 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | [(Z,3S,4S)-1-butoxy-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]hept-5-en-3-yl] acetate |
| SMILES | CCCCOCC[C@H](OC(C)=O)[C@@H](/C=C\C[C@H]1COC(CC)(CC)O1)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C29H46O7/c1-6-9-18-32-19-17-28(35-23(4)30)25(21-33-20-24-13-15-26(31-5)16-14-24)11-10-12-27-22-34-29(7-2,8-3)36-27/h10-11,13-16,25,27-28H,6-9,12,17-22H2,1-5H3/b11-10-/t25-,27-,28-/m0/s1 |
| InChIKey | QFBUBQJLLBYQTB-HVENSMKDSA-N |
| XLogP | 5.84 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|