C30H42O6 — CID 155245670
(Z,3S,4S)-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]-1-phenylmethoxyhept-5-en-3-ol (PubChem CID 155245670) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is (Z,3S,4S)-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]-1-phenylmethoxyhept-5-en-3-ol.
| Compound Name | (Z,3S,4S)-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]-1-phenylmethoxyhept-5-en-3-ol |
|---|---|
| PubChem CID | 155245670 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | (Z,3S,4S)-7-[(4S)-2,2-diethyl-1,3-dioxolan-4-yl]-4-[(4-methoxyphenyl)methoxymethyl]-1-phenylmethoxyhept-5-en-3-ol |
| SMILES | CCC1(CC)OC[C@H](C/C=C\[C@@H](COCc2ccc(OC)cc2)[C@@H](O)CCOCc2ccccc2)O1 |
| InChI | InChI=1S/C30H42O6/c1-4-30(5-2)35-23-28(36-30)13-9-12-26(22-34-21-25-14-16-27(32-3)17-15-25)29(31)18-19-33-20-24-10-7-6-8-11-24/h6-12,14-17,26,28-29,31H,4-5,13,18-23H2,1-3H3/b12-9-/t26-,28-,29-/m0/s1 |
| InChIKey | ZTRLXRXUBCVQCV-BEBRZNSKSA-N |
| XLogP | 5.67 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|